C24H34N2O6 — CID 46664481
methyl 4-[2-hydroxy-3-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]propoxy]benzoate (PubChem CID 46664481) has the molecular formula C24H34N2O6 and a molecular weight of 446.54 g/mol. Its IUPAC name is methyl 4-[2-hydroxy-3-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]propoxy]benzoate.
| Compound Name | methyl 4-[2-hydroxy-3-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]propoxy]benzoate |
|---|---|
| PubChem CID | 46664481 |
| Molecular Formula | C24H34N2O6 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | methyl 4-[2-hydroxy-3-[8-(2-methylbutan-2-yl)-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]propoxy]benzoate |
| SMILES | CCC(C)(C)C1CCC2(CC1)NC(=O)N(CC(O)COc1ccc(C(=O)OC)cc1)C2=O |
| InChI | InChI=1S/C24H34N2O6/c1-5-23(2,3)17-10-12-24(13-11-17)21(29)26(22(30)25-24)14-18(27)15-32-19-8-6-16(7-9-19)20(28)31-4/h6-9,17-18,27H,5,10-15H2,1-4H3,(H,25,30) |
| InChIKey | VWMPPYRXXXGLKN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|