C12H19N3O4 — CID 59093855
methyl (2S)-3-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)-2-methylpropanoate (PubChem CID 59093855) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is methyl (2S)-3-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)-2-methylpropanoate.
| Compound Name | methyl (2S)-3-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)-2-methylpropanoate |
|---|---|
| PubChem CID | 59093855 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | methyl (2S)-3-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-3-yl)-2-methylpropanoate |
| SMILES | COC(=O)[C@@H](C)CN1C(=O)NC2(CCNCC2)C1=O |
| InChI | InChI=1S/C12H19N3O4/c1-8(9(16)19-2)7-15-10(17)12(14-11(15)18)3-5-13-6-4-12/h8,13H,3-7H2,1-2H3,(H,14,18)/t8-/m0/s1 |
| InChIKey | GIRWLJOHCBXBSY-QMMMGPOBSA-N |
| XLogP | -0.53 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|