C10H13F3N2O — CID 106801647
6-[3-(trifluoromethyl)pyrazol-1-yl]hexan-3-one (PubChem CID 106801647) has the molecular formula C10H13F3N2O and a molecular weight of 234.22 g/mol. Its IUPAC name is 6-[3-(trifluoromethyl)pyrazol-1-yl]hexan-3-one.
| Compound Name | 6-[3-(trifluoromethyl)pyrazol-1-yl]hexan-3-one |
|---|---|
| PubChem CID | 106801647 |
| Molecular Formula | C10H13F3N2O |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 6-[3-(trifluoromethyl)pyrazol-1-yl]hexan-3-one |
| SMILES | CCC(=O)CCCn1ccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H13F3N2O/c1-2-8(16)4-3-6-15-7-5-9(14-15)10(11,12)13/h5,7H,2-4,6H2,1H3 |
| InChIKey | YMTALPWPKRSZKO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |