C10H15F3N2O — CID 106802540
6-[3-(trifluoromethyl)pyrazol-1-yl]hexan-3-ol (PubChem CID 106802540) has the molecular formula C10H15F3N2O and a molecular weight of 236.24 g/mol. Its IUPAC name is 6-[3-(trifluoromethyl)pyrazol-1-yl]hexan-3-ol.
| Compound Name | 6-[3-(trifluoromethyl)pyrazol-1-yl]hexan-3-ol |
|---|---|
| PubChem CID | 106802540 |
| Molecular Formula | C10H15F3N2O |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 6-[3-(trifluoromethyl)pyrazol-1-yl]hexan-3-ol |
| SMILES | CCC(O)CCCn1ccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H15F3N2O/c1-2-8(16)4-3-6-15-7-5-9(14-15)10(11,12)13/h5,7-8,16H,2-4,6H2,1H3 |
| InChIKey | VVDUXBMFWQAYLP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |