C7H8ClF3N2O — CID 112560244
1-chloro-3-[3-(trifluoromethyl)pyrazol-1-yl]propan-2-ol (PubChem CID 112560244) has the molecular formula C7H8ClF3N2O and a molecular weight of 228.60 g/mol. Its IUPAC name is 1-chloro-3-[3-(trifluoromethyl)pyrazol-1-yl]propan-2-ol.
| Compound Name | 1-chloro-3-[3-(trifluoromethyl)pyrazol-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 112560244 |
| Molecular Formula | C7H8ClF3N2O |
| Molecular Weight | 228.60 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 1-chloro-3-[3-(trifluoromethyl)pyrazol-1-yl]propan-2-ol |
| SMILES | OC(CCl)Cn1ccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C7H8ClF3N2O/c8-3-5(14)4-13-2-1-6(12-13)7(9,10)11/h1-2,5,14H,3-4H2 |
| InChIKey | GUQFPOJUCPZHES-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.60 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|