C10H16F3N3 — CID 106800335
6-[3-(trifluoromethyl)pyrazol-1-yl]hexan-3-amine (PubChem CID 106800335) has the molecular formula C10H16F3N3 and a molecular weight of 235.25 g/mol. Its IUPAC name is 6-[3-(trifluoromethyl)pyrazol-1-yl]hexan-3-amine.
| Compound Name | 6-[3-(trifluoromethyl)pyrazol-1-yl]hexan-3-amine |
|---|---|
| PubChem CID | 106800335 |
| Molecular Formula | C10H16F3N3 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 6-[3-(trifluoromethyl)pyrazol-1-yl]hexan-3-amine |
| SMILES | CCC(N)CCCn1ccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H16F3N3/c1-2-8(14)4-3-6-16-7-5-9(15-16)10(11,12)13/h5,7-8H,2-4,6,14H2,1H3 |
| InChIKey | PFJPJDDMBFCUBN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |