C9H12F3N3O2 — CID 63039948
methyl 2-amino-4-[3-(trifluoromethyl)pyrazol-1-yl]butanoate (PubChem CID 63039948) has the molecular formula C9H12F3N3O2 and a molecular weight of 251.21 g/mol. Its IUPAC name is methyl 2-amino-4-[3-(trifluoromethyl)pyrazol-1-yl]butanoate.
| Compound Name | methyl 2-amino-4-[3-(trifluoromethyl)pyrazol-1-yl]butanoate |
|---|---|
| PubChem CID | 63039948 |
| Molecular Formula | C9H12F3N3O2 |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | methyl 2-amino-4-[3-(trifluoromethyl)pyrazol-1-yl]butanoate |
| SMILES | COC(=O)C(N)CCn1ccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H12F3N3O2/c1-17-8(16)6(13)2-4-15-5-3-7(14-15)9(10,11)12/h3,5-6H,2,4,13H2,1H3 |
| InChIKey | MXIFNYKSMYCFJP-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |