C13H22F3N3O — CID 106810077
2-ethyl-2-(ethylamino)-5-[3-(trifluoromethyl)pyrazol-1-yl]pentan-1-ol (PubChem CID 106810077) has the molecular formula C13H22F3N3O and a molecular weight of 293.33 g/mol. Its IUPAC name is 2-ethyl-2-(ethylamino)-5-[3-(trifluoromethyl)pyrazol-1-yl]pentan-1-ol.
| Compound Name | 2-ethyl-2-(ethylamino)-5-[3-(trifluoromethyl)pyrazol-1-yl]pentan-1-ol |
|---|---|
| PubChem CID | 106810077 |
| Molecular Formula | C13H22F3N3O |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 2-ethyl-2-(ethylamino)-5-[3-(trifluoromethyl)pyrazol-1-yl]pentan-1-ol |
| SMILES | CCNC(CC)(CO)CCCn1ccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H22F3N3O/c1-3-12(10-20,17-4-2)7-5-8-19-9-6-11(18-19)13(14,15)16/h6,9,17,20H,3-5,7-8,10H2,1-2H3 |
| InChIKey | VDQXSJMDTAZISO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |