C13H22F3N3 — CID 55088610
N-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]heptan-2-amine (PubChem CID 55088610) has the molecular formula C13H22F3N3 and a molecular weight of 277.33 g/mol. Its IUPAC name is N-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]heptan-2-amine.
| Compound Name | N-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]heptan-2-amine |
|---|---|
| PubChem CID | 55088610 |
| Molecular Formula | C13H22F3N3 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]heptan-2-amine |
| SMILES | CCCCCC(C)NCCn1ccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H22F3N3/c1-3-4-5-6-11(2)17-8-10-19-9-7-12(18-19)13(14,15)16/h7,9,11,17H,3-6,8,10H2,1-2H3 |
| InChIKey | POIRAJPFYYXLFL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|