C18H29N3 — CID 63502282
N-[2-(5,6-dimethylbenzimidazol-1-yl)ethyl]heptan-2-amine (PubChem CID 63502282) has the molecular formula C18H29N3 and a molecular weight of 287.45 g/mol. Its IUPAC name is N-[2-(5,6-dimethylbenzimidazol-1-yl)ethyl]heptan-2-amine.
| Compound Name | N-[2-(5,6-dimethylbenzimidazol-1-yl)ethyl]heptan-2-amine |
|---|---|
| PubChem CID | 63502282 |
| Molecular Formula | C18H29N3 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.24 |
| IUPAC Name | N-[2-(5,6-dimethylbenzimidazol-1-yl)ethyl]heptan-2-amine |
| SMILES | CCCCCC(C)NCCn1cnc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C18H29N3/c1-5-6-7-8-16(4)19-9-10-21-13-20-17-11-14(2)15(3)12-18(17)21/h11-13,16,19H,5-10H2,1-4H3 |
| InChIKey | LMQYXHAPIMNFFC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|