C14H20N2S — CID 115650935
1-(3-ethylsulfanylpropyl)-5,6-dimethylbenzimidazole (PubChem CID 115650935) has the molecular formula C14H20N2S and a molecular weight of 248.39 g/mol. Its IUPAC name is 1-(3-ethylsulfanylpropyl)-5,6-dimethylbenzimidazole.
| Compound Name | 1-(3-ethylsulfanylpropyl)-5,6-dimethylbenzimidazole |
|---|---|
| PubChem CID | 115650935 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1-(3-ethylsulfanylpropyl)-5,6-dimethylbenzimidazole |
| SMILES | CCSCCCn1cnc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C14H20N2S/c1-4-17-7-5-6-16-10-15-13-8-11(2)12(3)9-14(13)16/h8-10H,4-7H2,1-3H3 |
| InChIKey | HFGQVUNPDKRPAL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|