C21H26N2O — CID 16995057
1-[4-(2,5-dimethylphenoxy)butyl]-5,6-dimethylbenzimidazole (PubChem CID 16995057) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-[4-(2,5-dimethylphenoxy)butyl]-5,6-dimethylbenzimidazole.
| Compound Name | 1-[4-(2,5-dimethylphenoxy)butyl]-5,6-dimethylbenzimidazole |
|---|---|
| PubChem CID | 16995057 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 1-[4-(2,5-dimethylphenoxy)butyl]-5,6-dimethylbenzimidazole |
| SMILES | Cc1ccc(C)c(OCCCCn2cnc3cc(C)c(C)cc32)c1 |
| InChI | InChI=1S/C21H26N2O/c1-15-7-8-16(2)21(11-15)24-10-6-5-9-23-14-22-19-12-17(3)18(4)13-20(19)23/h7-8,11-14H,5-6,9-10H2,1-4H3 |
| InChIKey | FDEDWPNJLRJSHI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|