C21H24N2O5 — CID 2949443
1-[4-(2,4-dimethylphenoxy)butyl]benzimidazole;oxalic acid (PubChem CID 2949443) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is 1-[4-(2,4-dimethylphenoxy)butyl]benzimidazole;oxalic acid.
| Compound Name | 1-[4-(2,4-dimethylphenoxy)butyl]benzimidazole;oxalic acid |
|---|---|
| PubChem CID | 2949443 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 1-[4-(2,4-dimethylphenoxy)butyl]benzimidazole;oxalic acid |
| SMILES | Cc1ccc(OCCCCn2cnc3ccccc32)c(C)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H22N2O.C2H2O4/c1-15-9-10-19(16(2)13-15)22-12-6-5-11-21-14-20-17-7-3-4-8-18(17)21;3-1(4)2(5)6/h3-4,7-10,13-14H,5-6,11-12H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | SZQSTRCCPNSFDF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|