C14H21NO — CID 125464507
1-[4-(2,5-dimethylphenoxy)butyl]aziridine (PubChem CID 125464507) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 1-[4-(2,5-dimethylphenoxy)butyl]aziridine.
| Compound Name | 1-[4-(2,5-dimethylphenoxy)butyl]aziridine |
|---|---|
| PubChem CID | 125464507 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 1-[4-(2,5-dimethylphenoxy)butyl]aziridine |
| SMILES | Cc1ccc(C)c(OCCCCN2CC2)c1 |
| InChI | InChI=1S/C14H21NO/c1-12-5-6-13(2)14(11-12)16-10-4-3-7-15-8-9-15/h5-6,11H,3-4,7-10H2,1-2H3 |
| InChIKey | LWLDKLHEJGZGGO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|