2-[4-[2-(2,5-dimethylphenoxy)ethyl]piperazin-1-yl]acetic acid

C16H24N2O3 — CID 43521786

IUPAC2-[4-[2-(2,5-dimethylphenoxy)ethyl]piperazin-1-yl]acetic acid
SMILESCc1ccc(C)c(OCCN2CCN(CC(=O)O)CC2)c1
InChIInChI=1S/C16H24N2O3/c1-13-3-4-14(2)15(11-13)21-10-9-17-5-7-18(8-6-17)12-16(19)20/h3-4,11H,5-10,12H2,1-2H3,(H,19,20)
InChIKeyMWWGQZPBGWJPKM-UHFFFAOYSA-N
MW292.38 g/mol
LogP1.38
Rot. Bonds6

About 2-[4-[2-(2,5-dimethylphenoxy)ethyl]piperazin-1-yl]acetic acid

2-[4-[2-(2,5-dimethylphenoxy)ethyl]piperazin-1-yl]acetic acid (PubChem CID 43521786) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-[4-[2-(2,5-dimethylphenoxy)ethyl]piperazin-1-yl]acetic acid.

Molecular Properties

Compound Name2-[4-[2-(2,5-dimethylphenoxy)ethyl]piperazin-1-yl]acetic acid
PubChem CID43521786
Molecular FormulaC16H24N2O3
Molecular Weight292.38 g/mol
Exact Mass292.18
IUPAC Name2-[4-[2-(2,5-dimethylphenoxy)ethyl]piperazin-1-yl]acetic acid
SMILESCc1ccc(C)c(OCCN2CCN(CC(=O)O)CC2)c1
InChIInChI=1S/C16H24N2O3/c1-13-3-4-14(2)15(11-13)21-10-9-17-5-7-18(8-6-17)12-16(19)20/h3-4,11H,5-10,12H2,1-2H3,(H,19,20)
InChIKeyMWWGQZPBGWJPKM-UHFFFAOYSA-N
XLogP1.38
TPSA53.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.38
LogP ≤ 51.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[4-[2-(2,5-dimethylphenoxy)ethyl]piperazin-1-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-[2-(2,5-dimethylphenoxy)ethyl]piperazin-1-yl]acetic acid?
The IUPAC name of 2-[4-[2-(2,5-dimethylphenoxy)ethyl]piperazin-1-yl]acetic acid (CID 43521786) is 2-[4-[2-(2,5-dimethylphenoxy)ethyl]piperazin-1-yl]acetic acid.
What is the SMILES notation for 2-[4-[2-(2,5-dimethylphenoxy)ethyl]piperazin-1-yl]acetic acid?
The canonical SMILES for 2-[4-[2-(2,5-dimethylphenoxy)ethyl]piperazin-1-yl]acetic acid is Cc1ccc(C)c(OCCN2CCN(CC(=O)O)CC2)c1.
What is the InChIKey of 2-[4-[2-(2,5-dimethylphenoxy)ethyl]piperazin-1-yl]acetic acid?
The InChIKey is MWWGQZPBGWJPKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O3/c1-13-3-4-14(2)15(11-13)21-10-9-17-5-7-18(8-6-17)12-16(19)20/h3-4,11H,5-10,12H2,1-2H3,(H,19,20).
What are the key properties of 2-[4-[2-(2,5-dimethylphenoxy)ethyl]piperazin-1-yl]acetic acid?
2-[4-[2-(2,5-dimethylphenoxy)ethyl]piperazin-1-yl]acetic acid has a molecular weight of 292.38 g/mol, XLogP of 1.38, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(2,5-dimethylphenoxy)ethyl]piperazin-1-yl]acetic acid is sourced from PubChem (CID 43521786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).