C17H27N3O — CID 66202000
1-(azetidin-3-yl)-4-[2-(2,5-dimethylphenoxy)ethyl]piperazine (PubChem CID 66202000) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-4-[2-(2,5-dimethylphenoxy)ethyl]piperazine.
| Compound Name | 1-(azetidin-3-yl)-4-[2-(2,5-dimethylphenoxy)ethyl]piperazine |
|---|---|
| PubChem CID | 66202000 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 1-(azetidin-3-yl)-4-[2-(2,5-dimethylphenoxy)ethyl]piperazine |
| SMILES | Cc1ccc(C)c(OCCN2CCN(C3CNC3)CC2)c1 |
| InChI | InChI=1S/C17H27N3O/c1-14-3-4-15(2)17(11-14)21-10-9-19-5-7-20(8-6-19)16-12-18-13-16/h3-4,11,16,18H,5-10,12-13H2,1-2H3 |
| InChIKey | ZQTPVDNYKDMFDB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |