C14H21NO3 — CID 106672249
1-[2-(2,5-dimethylphenoxy)ethyl]pyrrolidine-3,4-diol (PubChem CID 106672249) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-[2-(2,5-dimethylphenoxy)ethyl]pyrrolidine-3,4-diol.
| Compound Name | 1-[2-(2,5-dimethylphenoxy)ethyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106672249 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 1-[2-(2,5-dimethylphenoxy)ethyl]pyrrolidine-3,4-diol |
| SMILES | Cc1ccc(C)c(OCCN2CC(O)C(O)C2)c1 |
| InChI | InChI=1S/C14H21NO3/c1-10-3-4-11(2)14(7-10)18-6-5-15-8-12(16)13(17)9-15/h3-4,7,12-13,16-17H,5-6,8-9H2,1-2H3 |
| InChIKey | LQPQUXMNNNZTNI-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |