C14H20N4 — CID 54966278
5-(5,6-dimethylbenzimidazol-1-yl)pentanimidamide (PubChem CID 54966278) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is 5-(5,6-dimethylbenzimidazol-1-yl)pentanimidamide.
| Compound Name | 5-(5,6-dimethylbenzimidazol-1-yl)pentanimidamide |
|---|---|
| PubChem CID | 54966278 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 5-(5,6-dimethylbenzimidazol-1-yl)pentanimidamide |
| SMILES | [H]/N=C(\N)CCCCn1cnc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C14H20N4/c1-10-7-12-13(8-11(10)2)18(9-17-12)6-4-3-5-14(15)16/h7-9H,3-6H2,1-2H3,(H3,15,16) |
| InChIKey | MFDHGCUHOCISDV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|