C12H19N3O5 — CID 106671587
3-[4-(3,4-dihydroxypyrrolidin-1-yl)-4-oxobutyl]-1-methylimidazolidine-2,4-dione (PubChem CID 106671587) has the molecular formula C12H19N3O5 and a molecular weight of 285.30 g/mol. Its IUPAC name is 3-[4-(3,4-dihydroxypyrrolidin-1-yl)-4-oxobutyl]-1-methylimidazolidine-2,4-dione.
| Compound Name | 3-[4-(3,4-dihydroxypyrrolidin-1-yl)-4-oxobutyl]-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 106671587 |
| Molecular Formula | C12H19N3O5 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 3-[4-(3,4-dihydroxypyrrolidin-1-yl)-4-oxobutyl]-1-methylimidazolidine-2,4-dione |
| SMILES | CN1CC(=O)N(CCCC(=O)N2CC(O)C(O)C2)C1=O |
| InChI | InChI=1S/C12H19N3O5/c1-13-7-11(19)15(12(13)20)4-2-3-10(18)14-5-8(16)9(17)6-14/h8-9,16-17H,2-7H2,1H3 |
| InChIKey | PZNBPUAQGCDTHB-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|