C10H14F2N2O4 — CID 104857888
N-(2,2-difluoro-3-hydroxypropyl)-3-(2,5-dioxopyrrolidin-1-yl)propanamide (PubChem CID 104857888) has the molecular formula C10H14F2N2O4 and a molecular weight of 264.23 g/mol. Its IUPAC name is N-(2,2-difluoro-3-hydroxypropyl)-3-(2,5-dioxopyrrolidin-1-yl)propanamide.
| Compound Name | N-(2,2-difluoro-3-hydroxypropyl)-3-(2,5-dioxopyrrolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 104857888 |
| Molecular Formula | C10H14F2N2O4 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | N-(2,2-difluoro-3-hydroxypropyl)-3-(2,5-dioxopyrrolidin-1-yl)propanamide |
| SMILES | O=C(CCN1C(=O)CCC1=O)NCC(F)(F)CO |
| InChI | InChI=1S/C10H14F2N2O4/c11-10(12,6-15)5-13-7(16)3-4-14-8(17)1-2-9(14)18/h15H,1-6H2,(H,13,16) |
| InChIKey | XVJIDIIXUCCVDQ-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|