C17H23N3O3S — CID 19241784
N-(1,3-thiazol-2-yl)-4-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)butanamide (PubChem CID 19241784) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is N-(1,3-thiazol-2-yl)-4-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)butanamide.
| Compound Name | N-(1,3-thiazol-2-yl)-4-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)butanamide |
|---|---|
| PubChem CID | 19241784 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-(1,3-thiazol-2-yl)-4-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)butanamide |
| SMILES | CC12CCC(C(=O)N(CCCC(=O)Nc3nccs3)C1=O)C2(C)C |
| InChI | InChI=1S/C17H23N3O3S/c1-16(2)11-6-7-17(16,3)14(23)20(13(11)22)9-4-5-12(21)19-15-18-8-10-24-15/h8,10-11H,4-7,9H2,1-3H3,(H,18,19,21) |
| InChIKey | NPVLANQRSCDPRW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|