C31H39N3O6 — CID 19241893
N-[2,5-diethoxy-4-[4-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)butanoylamino]phenyl]benzamide (PubChem CID 19241893) has the molecular formula C31H39N3O6 and a molecular weight of 549.67 g/mol. Its IUPAC name is N-[2,5-diethoxy-4-[4-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)butanoylamino]phenyl]benzamide.
| Compound Name | N-[2,5-diethoxy-4-[4-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)butanoylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 19241893 |
| Molecular Formula | C31H39N3O6 |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.28 |
| IUPAC Name | N-[2,5-diethoxy-4-[4-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)butanoylamino]phenyl]benzamide |
| SMILES | CCOc1cc(NC(=O)c2ccccc2)c(OCC)cc1NC(=O)CCCN1C(=O)C2CCC(C)(C1=O)C2(C)C |
| InChI | InChI=1S/C31H39N3O6/c1-6-39-24-19-23(33-27(36)20-12-9-8-10-13-20)25(40-7-2)18-22(24)32-26(35)14-11-17-34-28(37)21-15-16-31(5,29(34)38)30(21,3)4/h8-10,12-13,18-19,21H,6-7,11,14-17H2,1-5H3,(H,32,35)(H,33,36) |
| InChIKey | LFVOPGSQXICEEG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|