About N-(5-phenylsulfanyl-1,3-thiazol-2-yl)acetamide
N-(5-phenylsulfanyl-1,3-thiazol-2-yl)acetamide (PubChem CID 15786742) has the molecular formula C11H10N2OS2
and a molecular weight of 250.35 g/mol. Its IUPAC name is N-(5-phenylsulfanyl-1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(5-phenylsulfanyl-1,3-thiazol-2-yl)acetamide |
| PubChem CID | 15786742 |
| Molecular Formula | C11H10N2OS2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | N-(5-phenylsulfanyl-1,3-thiazol-2-yl)acetamide |
| SMILES | CC(=O)Nc1ncc(Sc2ccccc2)s1 |
| InChI | InChI=1S/C11H10N2OS2/c1-8(14)13-11-12-7-10(16-11)15-9-5-3-2-4-6-9/h2-7H,1H3,(H,12,13,14) |
| InChIKey | YUNPJXKMGGFYSC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(5-phenylsulfanyl-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-phenylsulfanyl-1,3-thiazol-2-yl)acetamide?
The IUPAC name of N-(5-phenylsulfanyl-1,3-thiazol-2-yl)acetamide (CID 15786742) is N-(5-phenylsulfanyl-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for N-(5-phenylsulfanyl-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for N-(5-phenylsulfanyl-1,3-thiazol-2-yl)acetamide is CC(=O)Nc1ncc(Sc2ccccc2)s1.
What is the InChIKey of N-(5-phenylsulfanyl-1,3-thiazol-2-yl)acetamide?
The InChIKey is YUNPJXKMGGFYSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2OS2/c1-8(14)13-11-12-7-10(16-11)15-9-5-3-2-4-6-9/h2-7H,1H3,(H,12,13,14).
What are the key properties of N-(5-phenylsulfanyl-1,3-thiazol-2-yl)acetamide?
N-(5-phenylsulfanyl-1,3-thiazol-2-yl)acetamide has a molecular weight of 250.35 g/mol, XLogP of 3.25, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-phenylsulfanyl-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 15786742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).