C24H21ClN4O4S2 — CID 86620385
N-[5-[5-(benzenesulfonamido)-6-chloro-3-pyridinyl]-4-methyl-1,3-thiazol-2-yl]-2-phenylmethoxyacetamide (PubChem CID 86620385) has the molecular formula C24H21ClN4O4S2 and a molecular weight of 529.04 g/mol. Its IUPAC name is N-[5-[5-(benzenesulfonamido)-6-chloro-3-pyridinyl]-4-methyl-1,3-thiazol-2-yl]-2-phenylmethoxyacetamide.
| Compound Name | N-[5-[5-(benzenesulfonamido)-6-chloro-3-pyridinyl]-4-methyl-1,3-thiazol-2-yl]-2-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 86620385 |
| Molecular Formula | C24H21ClN4O4S2 |
| Molecular Weight | 529.04 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | N-[5-[5-(benzenesulfonamido)-6-chloro-3-pyridinyl]-4-methyl-1,3-thiazol-2-yl]-2-phenylmethoxyacetamide |
| SMILES | Cc1nc(NC(=O)COCc2ccccc2)sc1-c1cnc(Cl)c(NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H21ClN4O4S2/c1-16-22(34-24(27-16)28-21(30)15-33-14-17-8-4-2-5-9-17)18-12-20(23(25)26-13-18)29-35(31,32)19-10-6-3-7-11-19/h2-13,29H,14-15H2,1H3,(H,27,28,30) |
| InChIKey | CJUQZXUNHSHBCV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.04 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|