C15H15ClN6O3S2 — CID 11676261
N-[5-[6-chloro-5-[(1-methylimidazol-4-yl)sulfonylamino]-3-pyridinyl]-4-methyl-1,3-thiazol-2-yl]acetamide (PubChem CID 11676261) has the molecular formula C15H15ClN6O3S2 and a molecular weight of 426.91 g/mol. Its IUPAC name is N-[5-[6-chloro-5-[(1-methylimidazol-4-yl)sulfonylamino]-3-pyridinyl]-4-methyl-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-[6-chloro-5-[(1-methylimidazol-4-yl)sulfonylamino]-3-pyridinyl]-4-methyl-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 11676261 |
| Molecular Formula | C15H15ClN6O3S2 |
| Molecular Weight | 426.91 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | N-[5-[6-chloro-5-[(1-methylimidazol-4-yl)sulfonylamino]-3-pyridinyl]-4-methyl-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(C)c(-c2cnc(Cl)c(NS(=O)(=O)c3cn(C)cn3)c2)s1 |
| InChI | InChI=1S/C15H15ClN6O3S2/c1-8-13(26-15(19-8)20-9(2)23)10-4-11(14(16)17-5-10)21-27(24,25)12-6-22(3)7-18-12/h4-7,21H,1-3H3,(H,19,20,23) |
| InChIKey | IEAJLGHSWVPYIH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.91 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|