C18H16ClFN4O3S2 — CID 87177223
N-[5-[6-chloro-5-[(4-fluorophenyl)sulfonyl-methylamino]-3-pyridinyl]-4-methyl-1,3-thiazol-2-yl]acetamide (PubChem CID 87177223) has the molecular formula C18H16ClFN4O3S2 and a molecular weight of 454.94 g/mol. Its IUPAC name is N-[5-[6-chloro-5-[(4-fluorophenyl)sulfonyl-methylamino]-3-pyridinyl]-4-methyl-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-[6-chloro-5-[(4-fluorophenyl)sulfonyl-methylamino]-3-pyridinyl]-4-methyl-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 87177223 |
| Molecular Formula | C18H16ClFN4O3S2 |
| Molecular Weight | 454.94 g/mol |
| Exact Mass | 454.03 |
| IUPAC Name | N-[5-[6-chloro-5-[(4-fluorophenyl)sulfonyl-methylamino]-3-pyridinyl]-4-methyl-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(C)c(-c2cnc(Cl)c(N(C)S(=O)(=O)c3ccc(F)cc3)c2)s1 |
| InChI | InChI=1S/C18H16ClFN4O3S2/c1-10-16(28-18(22-10)23-11(2)25)12-8-15(17(19)21-9-12)24(3)29(26,27)14-6-4-13(20)5-7-14/h4-9H,1-3H3,(H,22,23,25) |
| InChIKey | CONZGCRGCLLFKJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.94 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|