C19H16N2O5S2 — CID 91561880
ethyl 2-oxo-2-[2-[(4-phenylphenyl)sulfonylamino]-1,3-thiazol-5-yl]acetate (PubChem CID 91561880) has the molecular formula C19H16N2O5S2 and a molecular weight of 416.48 g/mol. Its IUPAC name is ethyl 2-oxo-2-[2-[(4-phenylphenyl)sulfonylamino]-1,3-thiazol-5-yl]acetate.
| Compound Name | ethyl 2-oxo-2-[2-[(4-phenylphenyl)sulfonylamino]-1,3-thiazol-5-yl]acetate |
|---|---|
| PubChem CID | 91561880 |
| Molecular Formula | C19H16N2O5S2 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | ethyl 2-oxo-2-[2-[(4-phenylphenyl)sulfonylamino]-1,3-thiazol-5-yl]acetate |
| SMILES | CCOC(=O)C(=O)c1cnc(NS(=O)(=O)c2ccc(-c3ccccc3)cc2)s1 |
| InChI | InChI=1S/C19H16N2O5S2/c1-2-26-18(23)17(22)16-12-20-19(27-16)21-28(24,25)15-10-8-14(9-11-15)13-6-4-3-5-7-13/h3-12H,2H2,1H3,(H,20,21) |
| InChIKey | STCGCBGZIWBSIH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|