C14H14N2O6S2 — CID 161014927
ethyl 2-(2-methyl-1,3-thiazol-5-yl)-2-oxoacetate;2-(2-methyl-1,3-thiazol-5-yl)-2-oxoacetic acid (PubChem CID 161014927) has the molecular formula C14H14N2O6S2 and a molecular weight of 370.41 g/mol. Its IUPAC name is ethyl 2-(2-methyl-1,3-thiazol-5-yl)-2-oxoacetate;2-(2-methyl-1,3-thiazol-5-yl)-2-oxoacetic acid.
| Compound Name | ethyl 2-(2-methyl-1,3-thiazol-5-yl)-2-oxoacetate;2-(2-methyl-1,3-thiazol-5-yl)-2-oxoacetic acid |
|---|---|
| PubChem CID | 161014927 |
| Molecular Formula | C14H14N2O6S2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | ethyl 2-(2-methyl-1,3-thiazol-5-yl)-2-oxoacetate;2-(2-methyl-1,3-thiazol-5-yl)-2-oxoacetic acid |
| SMILES | CCOC(=O)C(=O)c1cnc(C)s1.Cc1ncc(C(=O)C(=O)O)s1 |
| InChI | InChI=1S/C8H9NO3S.C6H5NO3S/c1-3-12-8(11)7(10)6-4-9-5(2)13-6;1-3-7-2-4(11-3)5(8)6(9)10/h4H,3H2,1-2H3;2H,1H3,(H,9,10) |
| InChIKey | TXPHAASZEPGNBT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 123.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|