C13H18N2O7S — CID 144558620
ethyl 2-[2-[[(2S,4R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]-2-oxoacetate (PubChem CID 144558620) has the molecular formula C13H18N2O7S and a molecular weight of 346.36 g/mol. Its IUPAC name is ethyl 2-[2-[[(2S,4R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]-2-oxoacetate.
| Compound Name | ethyl 2-[2-[[(2S,4R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 144558620 |
| Molecular Formula | C13H18N2O7S |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | ethyl 2-[2-[[(2S,4R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]-1,3-thiazol-5-yl]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1cnc(N[C@@H]2C[C@@H](O)C(O)C(CO)O2)s1 |
| InChI | InChI=1S/C13H18N2O7S/c1-2-21-12(20)11(19)8-4-14-13(23-8)15-9-3-6(17)10(18)7(5-16)22-9/h4,6-7,9-10,16-18H,2-3,5H2,1H3,(H,14,15)/t6-,7?,9+,10?/m1/s1 |
| InChIKey | JQHZCIFDSJFUDR-SDFOGQBQSA-N |
| XLogP | -0.87 |
| TPSA | 138.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|