C19H26N2O6S — CID 163939279
1-adamantyl-[2-[[(2S,5R)-4,5-dihydroxy-6-(hydroxymethyl)-1,3-dioxan-2-yl]amino]-1,3-thiazol-5-yl]methanone (PubChem CID 163939279) has the molecular formula C19H26N2O6S and a molecular weight of 410.49 g/mol. Its IUPAC name is 1-adamantyl-[2-[[(2S,5R)-4,5-dihydroxy-6-(hydroxymethyl)-1,3-dioxan-2-yl]amino]-1,3-thiazol-5-yl]methanone.
| Compound Name | 1-adamantyl-[2-[[(2S,5R)-4,5-dihydroxy-6-(hydroxymethyl)-1,3-dioxan-2-yl]amino]-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 163939279 |
| Molecular Formula | C19H26N2O6S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 1-adamantyl-[2-[[(2S,5R)-4,5-dihydroxy-6-(hydroxymethyl)-1,3-dioxan-2-yl]amino]-1,3-thiazol-5-yl]methanone |
| SMILES | O=C(c1cnc(N[C@@H]2OC(O)[C@H](O)C(CO)O2)s1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H26N2O6S/c22-8-12-14(23)16(25)27-18(26-12)21-17-20-7-13(28-17)15(24)19-4-9-1-10(5-19)3-11(2-9)6-19/h7,9-12,14,16,18,22-23,25H,1-6,8H2,(H,20,21)/t9?,10?,11?,12?,14-,16?,18+,19?/m1/s1 |
| InChIKey | RPOVECKBBZXVKI-LYWUERSESA-N |
| XLogP | 1.32 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |