C12H17NO6S2 — CID 126561042
1-[2-[[(2S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methylsulfanyl]-1,3-thiazol-5-yl]ethanone (PubChem CID 126561042) has the molecular formula C12H17NO6S2 and a molecular weight of 335.40 g/mol. Its IUPAC name is 1-[2-[[(2S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methylsulfanyl]-1,3-thiazol-5-yl]ethanone.
| Compound Name | 1-[2-[[(2S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methylsulfanyl]-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 126561042 |
| Molecular Formula | C12H17NO6S2 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 1-[2-[[(2S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]methylsulfanyl]-1,3-thiazol-5-yl]ethanone |
| SMILES | CC(=O)c1cnc(SC[C@H]2OC(CO)[C@@H](O)C(O)C2O)s1 |
| InChI | InChI=1S/C12H17NO6S2/c1-5(15)8-2-13-12(21-8)20-4-7-10(17)11(18)9(16)6(3-14)19-7/h2,6-7,9-11,14,16-18H,3-4H2,1H3/t6?,7-,9-,10?,11?/m1/s1 |
| InChIKey | BKVAUCNFHZQJLX-BQUPYYBTSA-N |
| XLogP | -0.72 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|