C9H5F3N2O2S2 — CID 175775889
2,5-difluoro-N-(5-fluoro-1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 175775889) has the molecular formula C9H5F3N2O2S2 and a molecular weight of 294.28 g/mol. Its IUPAC name is 2,5-difluoro-N-(5-fluoro-1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 2,5-difluoro-N-(5-fluoro-1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 175775889 |
| Molecular Formula | C9H5F3N2O2S2 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 293.97 |
| IUPAC Name | 2,5-difluoro-N-(5-fluoro-1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ncc(F)s1)c1cc(F)ccc1F |
| InChI | InChI=1S/C9H5F3N2O2S2/c10-5-1-2-6(11)7(3-5)18(15,16)14-9-13-4-8(12)17-9/h1-4H,(H,13,14) |
| InChIKey | FRANXRFOEQMIJE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |