C12H11F2N3O3S — CID 122302105
N-(2-ethoxypyrimidin-5-yl)-2,5-difluorobenzenesulfonamide (PubChem CID 122302105) has the molecular formula C12H11F2N3O3S and a molecular weight of 315.30 g/mol. Its IUPAC name is N-(2-ethoxypyrimidin-5-yl)-2,5-difluorobenzenesulfonamide.
| Compound Name | N-(2-ethoxypyrimidin-5-yl)-2,5-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 122302105 |
| Molecular Formula | C12H11F2N3O3S |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | N-(2-ethoxypyrimidin-5-yl)-2,5-difluorobenzenesulfonamide |
| SMILES | CCOc1ncc(NS(=O)(=O)c2cc(F)ccc2F)cn1 |
| InChI | InChI=1S/C12H11F2N3O3S/c1-2-20-12-15-6-9(7-16-12)17-21(18,19)11-5-8(13)3-4-10(11)14/h3-7,17H,2H2,1H3 |
| InChIKey | MFEQLWWSJZPGEQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |