C21H27NO3S — CID 22356861
N-(benzenesulfonyl)-4-(2,4,4-trimethylpentan-2-yl)benzamide (PubChem CID 22356861) has the molecular formula C21H27NO3S and a molecular weight of 373.52 g/mol. Its IUPAC name is N-(benzenesulfonyl)-4-(2,4,4-trimethylpentan-2-yl)benzamide.
| Compound Name | N-(benzenesulfonyl)-4-(2,4,4-trimethylpentan-2-yl)benzamide |
|---|---|
| PubChem CID | 22356861 |
| Molecular Formula | C21H27NO3S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | N-(benzenesulfonyl)-4-(2,4,4-trimethylpentan-2-yl)benzamide |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(C(=O)NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H27NO3S/c1-20(2,3)15-21(4,5)17-13-11-16(12-14-17)19(23)22-26(24,25)18-9-7-6-8-10-18/h6-14H,15H2,1-5H3,(H,22,23) |
| InChIKey | LXPNPHIAMVLCFJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |