C10H7ClF4N2O3 — CID 103577982
4-chloro-3-nitro-N-(2,2,3,3-tetrafluoropropyl)benzamide (PubChem CID 103577982) has the molecular formula C10H7ClF4N2O3 and a molecular weight of 314.62 g/mol. Its IUPAC name is 4-chloro-3-nitro-N-(2,2,3,3-tetrafluoropropyl)benzamide.
| Compound Name | 4-chloro-3-nitro-N-(2,2,3,3-tetrafluoropropyl)benzamide |
|---|---|
| PubChem CID | 103577982 |
| Molecular Formula | C10H7ClF4N2O3 |
| Molecular Weight | 314.62 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 4-chloro-3-nitro-N-(2,2,3,3-tetrafluoropropyl)benzamide |
| SMILES | O=C(NCC(F)(F)C(F)F)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H7ClF4N2O3/c11-6-2-1-5(3-7(6)17(19)20)8(18)16-4-10(14,15)9(12)13/h1-3,9H,4H2,(H,16,18) |
| InChIKey | FGGMNRVLTKXWFD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.62 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|