C22H17F3N2O5 — CID 1328913
N-(3-methoxy-4-methylphenyl)-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzamide (PubChem CID 1328913) has the molecular formula C22H17F3N2O5 and a molecular weight of 446.38 g/mol. Its IUPAC name is N-(3-methoxy-4-methylphenyl)-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzamide.
| Compound Name | N-(3-methoxy-4-methylphenyl)-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzamide |
|---|---|
| PubChem CID | 1328913 |
| Molecular Formula | C22H17F3N2O5 |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | N-(3-methoxy-4-methylphenyl)-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzamide |
| SMILES | COc1cc(NC(=O)c2ccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])cc2)ccc1C |
| InChI | InChI=1S/C22H17F3N2O5/c1-13-3-7-16(12-20(13)31-2)26-21(28)14-4-8-17(9-5-14)32-19-10-6-15(22(23,24)25)11-18(19)27(29)30/h3-12H,1-2H3,(H,26,28) |
| InChIKey | KYFTUPNPHZBCCM-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|