C26H21F6N3O6 — CID 16761441
3-methoxy-N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzamide (PubChem CID 16761441) has the molecular formula C26H21F6N3O6 and a molecular weight of 585.46 g/mol. Its IUPAC name is 3-methoxy-N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzamide.
| Compound Name | 3-methoxy-N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzamide |
|---|---|
| PubChem CID | 16761441 |
| Molecular Formula | C26H21F6N3O6 |
| Molecular Weight | 585.46 g/mol |
| Exact Mass | 585.13 |
| IUPAC Name | 3-methoxy-N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(N3CCOCC3)c(C(F)(F)F)c2)ccc1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H21F6N3O6/c1-39-23-12-15(2-6-22(23)41-21-7-3-16(25(27,28)29)13-20(21)35(37)38)24(36)33-17-4-5-19(18(14-17)26(30,31)32)34-8-10-40-11-9-34/h2-7,12-14H,8-11H2,1H3,(H,33,36) |
| InChIKey | PKSJMLYDGDJKBG-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.46 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|