C30H22F6N2O7 — CID 16761442
3-methoxy-N-[2-[(4-methoxyphenyl)methoxy]-5-(trifluoromethyl)phenyl]-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzamide (PubChem CID 16761442) has the molecular formula C30H22F6N2O7 and a molecular weight of 636.50 g/mol. Its IUPAC name is 3-methoxy-N-[2-[(4-methoxyphenyl)methoxy]-5-(trifluoromethyl)phenyl]-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzamide.
| Compound Name | 3-methoxy-N-[2-[(4-methoxyphenyl)methoxy]-5-(trifluoromethyl)phenyl]-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzamide |
|---|---|
| PubChem CID | 16761442 |
| Molecular Formula | C30H22F6N2O7 |
| Molecular Weight | 636.50 g/mol |
| Exact Mass | 636.13 |
| IUPAC Name | 3-methoxy-N-[2-[(4-methoxyphenyl)methoxy]-5-(trifluoromethyl)phenyl]-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzamide |
| SMILES | COc1ccc(COc2ccc(C(F)(F)F)cc2NC(=O)c2ccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c(OC)c2)cc1 |
| InChI | InChI=1S/C30H22F6N2O7/c1-42-21-8-3-17(4-9-21)16-44-24-11-6-19(29(31,32)33)14-22(24)37-28(39)18-5-10-26(27(13-18)43-2)45-25-12-7-20(30(34,35)36)15-23(25)38(40)41/h3-15H,16H2,1-2H3,(H,37,39) |
| InChIKey | MNIDALKYTKSYDD-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 109.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.50 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|