C19H14N4OS — CID 4054270
N-[5-[1-cyano-2-(3-methylphenyl)ethenyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 4054270) has the molecular formula C19H14N4OS and a molecular weight of 346.42 g/mol. Its IUPAC name is N-[5-[1-cyano-2-(3-methylphenyl)ethenyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | N-[5-[1-cyano-2-(3-methylphenyl)ethenyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 4054270 |
| Molecular Formula | C19H14N4OS |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N-[5-[1-cyano-2-(3-methylphenyl)ethenyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | Cc1cccc(C=C(C#N)c2nnc(NC(=O)c3ccccc3)s2)c1 |
| InChI | InChI=1S/C19H14N4OS/c1-13-6-5-7-14(10-13)11-16(12-20)18-22-23-19(25-18)21-17(24)15-8-3-2-4-9-15/h2-11H,1H3,(H,21,23,24) |
| InChIKey | GUKVNFCMTAHFQU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|