C26H19N5O5S — CID 92988907
N-[5-[(Z)-1-cyano-2-[5-nitro-2-(2-phenoxyethoxy)phenyl]ethenyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 92988907) has the molecular formula C26H19N5O5S and a molecular weight of 513.54 g/mol. Its IUPAC name is N-[5-[(Z)-1-cyano-2-[5-nitro-2-(2-phenoxyethoxy)phenyl]ethenyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | N-[5-[(Z)-1-cyano-2-[5-nitro-2-(2-phenoxyethoxy)phenyl]ethenyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 92988907 |
| Molecular Formula | C26H19N5O5S |
| Molecular Weight | 513.54 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | N-[5-[(Z)-1-cyano-2-[5-nitro-2-(2-phenoxyethoxy)phenyl]ethenyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | N#C/C(=C/c1cc([N+](=O)[O-])ccc1OCCOc1ccccc1)c1nnc(NC(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C26H19N5O5S/c27-17-20(25-29-30-26(37-25)28-24(32)18-7-3-1-4-8-18)15-19-16-21(31(33)34)11-12-23(19)36-14-13-35-22-9-5-2-6-10-22/h1-12,15-16H,13-14H2,(H,28,30,32)/b20-15- |
| InChIKey | SZZCOGHPAZUSCB-HKWRFOASSA-N |
| XLogP | 5.22 |
| TPSA | 140.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.54 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|