C17H14N2O3S — CID 6447933
(E)-2-cyano-3-[3,4-dihydroxy-5-(phenylsulfanylmethyl)phenyl]prop-2-enamide (PubChem CID 6447933) has the molecular formula C17H14N2O3S and a molecular weight of 326.38 g/mol. Its IUPAC name is (E)-2-cyano-3-[3,4-dihydroxy-5-(phenylsulfanylmethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3,4-dihydroxy-5-(phenylsulfanylmethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 6447933 |
| Molecular Formula | C17H14N2O3S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | (E)-2-cyano-3-[3,4-dihydroxy-5-(phenylsulfanylmethyl)phenyl]prop-2-enamide |
| SMILES | N#C/C(=C\c1cc(O)c(O)c(CSc2ccccc2)c1)C(N)=O |
| InChI | InChI=1S/C17H14N2O3S/c18-9-12(17(19)22)6-11-7-13(16(21)15(20)8-11)10-23-14-4-2-1-3-5-14/h1-8,20-21H,10H2,(H2,19,22)/b12-6+ |
| InChIKey | BIMTVOGHGRSMBT-WUXMJOGZSA-N |
| XLogP | 2.78 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|