C20H16N2O3S2 — CID 58066442
(2E)-2-[[3-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-hydroxy-5-methoxyphenyl]methylidene]-3-oxobutanenitrile (PubChem CID 58066442) has the molecular formula C20H16N2O3S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is (2E)-2-[[3-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-hydroxy-5-methoxyphenyl]methylidene]-3-oxobutanenitrile.
| Compound Name | (2E)-2-[[3-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-hydroxy-5-methoxyphenyl]methylidene]-3-oxobutanenitrile |
|---|---|
| PubChem CID | 58066442 |
| Molecular Formula | C20H16N2O3S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | (2E)-2-[[3-(1,3-benzothiazol-2-ylsulfanylmethyl)-4-hydroxy-5-methoxyphenyl]methylidene]-3-oxobutanenitrile |
| SMILES | COc1cc(/C=C(\C#N)C(C)=O)cc(CSc2nc3ccccc3s2)c1O |
| InChI | InChI=1S/C20H16N2O3S2/c1-12(23)14(10-21)7-13-8-15(19(24)17(9-13)25-2)11-26-20-22-16-5-3-4-6-18(16)27-20/h3-9,24H,11H2,1-2H3/b14-7+ |
| InChIKey | OEEBXPUMRKRXJK-VGOFMYFVSA-N |
| XLogP | 4.80 |
| TPSA | 83.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|