C12H11NO4 — CID 99646704
(Z)-2-cyano-3-(3,5-dimethoxyphenyl)prop-2-enoic acid (PubChem CID 99646704) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is (Z)-2-cyano-3-(3,5-dimethoxyphenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-cyano-3-(3,5-dimethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 99646704 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | (Z)-2-cyano-3-(3,5-dimethoxyphenyl)prop-2-enoic acid |
| SMILES | COc1cc(/C=C(/C#N)C(=O)O)cc(OC)c1 |
| InChI | InChI=1S/C12H11NO4/c1-16-10-4-8(5-11(6-10)17-2)3-9(7-13)12(14)15/h3-6H,1-2H3,(H,14,15)/b9-3- |
| InChIKey | WZSSRMAWSJFHCL-OQFOIZHKSA-N |
| XLogP | 1.70 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|