C16H15N3O3 — CID 145215162
(E)-3-(3-amino-4,5-dihydroxyphenyl)-2-cyano-N-cyclohexa-1,5-dien-1-ylprop-2-enamide (PubChem CID 145215162) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is (E)-3-(3-amino-4,5-dihydroxyphenyl)-2-cyano-N-cyclohexa-1,5-dien-1-ylprop-2-enamide.
| Compound Name | (E)-3-(3-amino-4,5-dihydroxyphenyl)-2-cyano-N-cyclohexa-1,5-dien-1-ylprop-2-enamide |
|---|---|
| PubChem CID | 145215162 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | (E)-3-(3-amino-4,5-dihydroxyphenyl)-2-cyano-N-cyclohexa-1,5-dien-1-ylprop-2-enamide |
| SMILES | N#C/C(=C\c1cc(N)c(O)c(O)c1)C(=O)NC1=CCCC=C1 |
| InChI | InChI=1S/C16H15N3O3/c17-9-11(16(22)19-12-4-2-1-3-5-12)6-10-7-13(18)15(21)14(20)8-10/h2,4-8,20-21H,1,3,18H2,(H,19,22)/b11-6+ |
| InChIKey | ORWTXYKSIJWHCT-IZZDOVSWSA-N |
| XLogP | 1.94 |
| TPSA | 119.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|