C17H10ClN3O3 — CID 54450974
N-(3-chlorophenyl)-2-cyano-3-(3-cyano-4,5-dihydroxyphenyl)prop-2-enamide (PubChem CID 54450974) has the molecular formula C17H10ClN3O3 and a molecular weight of 339.74 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-cyano-3-(3-cyano-4,5-dihydroxyphenyl)prop-2-enamide.
| Compound Name | N-(3-chlorophenyl)-2-cyano-3-(3-cyano-4,5-dihydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 54450974 |
| Molecular Formula | C17H10ClN3O3 |
| Molecular Weight | 339.74 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | N-(3-chlorophenyl)-2-cyano-3-(3-cyano-4,5-dihydroxyphenyl)prop-2-enamide |
| SMILES | N#CC(=Cc1cc(O)c(O)c(C#N)c1)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H10ClN3O3/c18-13-2-1-3-14(7-13)21-17(24)12(9-20)5-10-4-11(8-19)16(23)15(22)6-10/h1-7,22-23H,(H,21,24) |
| InChIKey | WUYJJSIWICMQDS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 117.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.74 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|