C16H13N3O4 — CID 142292142
(E)-2-cyano-N-cyclohexa-1,5-dien-1-yl-3-(3,4-dihydroxy-5-nitrosophenyl)prop-2-enamide (PubChem CID 142292142) has the molecular formula C16H13N3O4 and a molecular weight of 311.30 g/mol. Its IUPAC name is (E)-2-cyano-N-cyclohexa-1,5-dien-1-yl-3-(3,4-dihydroxy-5-nitrosophenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-cyclohexa-1,5-dien-1-yl-3-(3,4-dihydroxy-5-nitrosophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 142292142 |
| Molecular Formula | C16H13N3O4 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | (E)-2-cyano-N-cyclohexa-1,5-dien-1-yl-3-(3,4-dihydroxy-5-nitrosophenyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1cc(O)c(O)c(N=O)c1)C(=O)NC1=CCCC=C1 |
| InChI | InChI=1S/C16H13N3O4/c17-9-11(16(22)18-12-4-2-1-3-5-12)6-10-7-13(19-23)15(21)14(20)8-10/h2,4-8,20-21H,1,3H2,(H,18,22)/b11-6+ |
| InChIKey | VMQJVLOKRNEPPE-IZZDOVSWSA-N |
| XLogP | 2.75 |
| TPSA | 122.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|