C14H12N2O5S — CID 58701414
2-cyano-3-[4-[ethenyl-[1-(trioxidanylsulfanyl)ethenyl]amino]phenyl]prop-2-enoic acid (PubChem CID 58701414) has the molecular formula C14H12N2O5S and a molecular weight of 320.33 g/mol. Its IUPAC name is 2-cyano-3-[4-[ethenyl-[1-(trioxidanylsulfanyl)ethenyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | 2-cyano-3-[4-[ethenyl-[1-(trioxidanylsulfanyl)ethenyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 58701414 |
| Molecular Formula | C14H12N2O5S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 2-cyano-3-[4-[ethenyl-[1-(trioxidanylsulfanyl)ethenyl]amino]phenyl]prop-2-enoic acid |
| SMILES | C=CN(C(=C)SOOO)c1ccc(C=C(C#N)C(=O)O)cc1 |
| InChI | InChI=1S/C14H12N2O5S/c1-3-16(10(2)22-21-20-19)13-6-4-11(5-7-13)8-12(9-15)14(17)18/h3-8,19H,1-2H2,(H,17,18) |
| InChIKey | KCHNLXAIWYDKTB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|