C18H12N2OS — CID 2212670
(2E,4E)-5-(furan-2-yl)-2-(4-phenyl-1,3-thiazol-2-yl)penta-2,4-dienenitrile (PubChem CID 2212670) has the molecular formula C18H12N2OS and a molecular weight of 304.37 g/mol. Its IUPAC name is (2E,4E)-5-(furan-2-yl)-2-(4-phenyl-1,3-thiazol-2-yl)penta-2,4-dienenitrile.
| Compound Name | (2E,4E)-5-(furan-2-yl)-2-(4-phenyl-1,3-thiazol-2-yl)penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 2212670 |
| Molecular Formula | C18H12N2OS |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (2E,4E)-5-(furan-2-yl)-2-(4-phenyl-1,3-thiazol-2-yl)penta-2,4-dienenitrile |
| SMILES | N#C/C(=C\C=C\c1ccco1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H12N2OS/c19-12-15(8-4-9-16-10-5-11-21-16)18-20-17(13-22-18)14-6-2-1-3-7-14/h1-11,13H/b9-4+,15-8+ |
| InChIKey | ZDMBFARHZHYVFJ-NRCQFBCTSA-N |
| XLogP | 5.02 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|