C18H11N3O3S — CID 1299454
(2E,4E)-5-(furan-2-yl)-2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]penta-2,4-dienenitrile (PubChem CID 1299454) has the molecular formula C18H11N3O3S and a molecular weight of 349.37 g/mol. Its IUPAC name is (2E,4E)-5-(furan-2-yl)-2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]penta-2,4-dienenitrile.
| Compound Name | (2E,4E)-5-(furan-2-yl)-2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 1299454 |
| Molecular Formula | C18H11N3O3S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | (2E,4E)-5-(furan-2-yl)-2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]penta-2,4-dienenitrile |
| SMILES | N#C/C(=C\C=C\c1ccco1)c1nc(-c2ccc([N+](=O)[O-])cc2)cs1 |
| InChI | InChI=1S/C18H11N3O3S/c19-11-14(3-1-4-16-5-2-10-24-16)18-20-17(12-25-18)13-6-8-15(9-7-13)21(22)23/h1-10,12H/b4-1+,14-3+ |
| InChIKey | QKXMKVLCAZSHNU-ITPRVWRUSA-N |
| XLogP | 4.93 |
| TPSA | 92.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|