C18H14N4O — CID 51096526
(2Z,4E)-5-(furan-2-yl)-2-(4-methyl-5-phenyl-1,2,4-triazol-3-yl)penta-2,4-dienenitrile (PubChem CID 51096526) has the molecular formula C18H14N4O and a molecular weight of 302.34 g/mol. Its IUPAC name is (2Z,4E)-5-(furan-2-yl)-2-(4-methyl-5-phenyl-1,2,4-triazol-3-yl)penta-2,4-dienenitrile.
| Compound Name | (2Z,4E)-5-(furan-2-yl)-2-(4-methyl-5-phenyl-1,2,4-triazol-3-yl)penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 51096526 |
| Molecular Formula | C18H14N4O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (2Z,4E)-5-(furan-2-yl)-2-(4-methyl-5-phenyl-1,2,4-triazol-3-yl)penta-2,4-dienenitrile |
| SMILES | Cn1c(/C(C#N)=C\C=C\c2ccco2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C18H14N4O/c1-22-17(14-7-3-2-4-8-14)20-21-18(22)15(13-19)9-5-10-16-11-6-12-23-16/h2-12H,1H3/b10-5+,15-9- |
| InChIKey | DOEFRBWDDQRNES-QTJUQDGQSA-N |
| XLogP | 3.70 |
| TPSA | 67.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|